C16H16FNO3 — CID 61048704
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-fluoroanilino)ethanol (PubChem CID 61048704) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-fluoroanilino)ethanol.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-fluoroanilino)ethanol |
|---|---|
| PubChem CID | 61048704 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(3-fluoroanilino)ethanol |
| SMILES | OCC(Nc1cccc(F)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H16FNO3/c17-12-2-1-3-13(9-12)18-14(10-19)11-4-5-15-16(8-11)21-7-6-20-15/h1-5,8-9,14,18-19H,6-7,10H2 |
| InChIKey | RGKRROQNODMEOQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |