C16H16ClNO3 — CID 61047739
2-(2-chloroanilino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol (PubChem CID 61047739) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-(2-chloroanilino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol.
| Compound Name | 2-(2-chloroanilino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol |
|---|---|
| PubChem CID | 61047739 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(2-chloroanilino)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol |
| SMILES | OCC(Nc1ccccc1Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H16ClNO3/c17-12-3-1-2-4-13(12)18-14(10-19)11-5-6-15-16(9-11)21-8-7-20-15/h1-6,9,14,18-19H,7-8,10H2 |
| InChIKey | LMCANWWFICJWJI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |