C13H11NO3 — CID 82537338
3-(1,3-benzodioxol-5-ylamino)phenol (PubChem CID 82537338) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)phenol.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)phenol |
|---|---|
| PubChem CID | 82537338 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)phenol |
| SMILES | Oc1cccc(Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C13H11NO3/c15-11-3-1-2-9(6-11)14-10-4-5-12-13(7-10)17-8-16-12/h1-7,14-15H,8H2 |
| InChIKey | KTJJMESPXFUXGW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |