C14H11NO4 — CID 643226
2-(1,3-benzodioxol-5-ylamino)benzoic acid (PubChem CID 643226) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)benzoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)benzoic acid |
|---|---|
| PubChem CID | 643226 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H11NO4/c16-14(17)10-3-1-2-4-11(10)15-9-5-6-12-13(7-9)19-8-18-12/h1-7,15H,8H2,(H,16,17) |
| InChIKey | SZNBYURCUPNFSH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |