C21H17NO4 — CID 70125837
2-[3-(1,3-benzodioxol-5-yl)-2-methylanilino]benzoic acid (PubChem CID 70125837) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)-2-methylanilino]benzoic acid.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)-2-methylanilino]benzoic acid |
|---|---|
| PubChem CID | 70125837 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)-2-methylanilino]benzoic acid |
| SMILES | Cc1c(Nc2ccccc2C(=O)O)cccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H17NO4/c1-13-15(14-9-10-19-20(11-14)26-12-25-19)6-4-8-17(13)22-18-7-3-2-5-16(18)21(23)24/h2-11,22H,12H2,1H3,(H,23,24) |
| InChIKey | DLFGGSSLRUTROJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |