About CID 10739949
CID 10739949 (PubChem CID 10739949) has the molecular formula C18H24NO2Sn
and a molecular weight of 405.11 g/mol.
Molecular Properties
| Compound Name | CID 10739949 |
| PubChem CID | 10739949 |
| Molecular Formula | C18H24NO2Sn |
| Molecular Weight | 405.11 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | — |
| SMILES | C[Sn](C)C.Cc1cccc(Nc2ccccc2C(=O)O)c1C |
| InChI | InChI=1S/C15H15NO2.3CH3.Sn/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;;;;/h3-9,16H,1-2H3,(H,17,18);3*1H3; |
| InChIKey | HSYTYXDJLWUFSP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.11 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 10739949 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10739949?
The IUPAC name of CID 10739949 (CID 10739949) is not available.
What is the SMILES notation for CID 10739949?
The canonical SMILES for CID 10739949 is C[Sn](C)C.Cc1cccc(Nc2ccccc2C(=O)O)c1C.
What is the InChIKey of CID 10739949?
The InChIKey is HSYTYXDJLWUFSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2.3CH3.Sn/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;;;;/h3-9,16H,1-2H3,(H,17,18);3*1H3;.
What are the key properties of CID 10739949?
CID 10739949 has a molecular weight of 405.11 g/mol, XLogP of 5.12, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10739949 is sourced from PubChem (CID 10739949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).