C42H40N4O4 — CID 139205083
bis(2-(2,3-dimethylanilino)benzoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139205083) has the molecular formula C42H40N4O4 and a molecular weight of 664.81 g/mol. Its IUPAC name is bis(2-(2,3-dimethylanilino)benzoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
| Compound Name | bis(2-(2,3-dimethylanilino)benzoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
|---|---|
| PubChem CID | 139205083 |
| Molecular Formula | C42H40N4O4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | bis(2-(2,3-dimethylanilino)benzoic acid);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.Cc1cccc(Nc2ccccc2C(=O)O)c1C.Cc1cccc(Nc2ccccc2C(=O)O)c1C |
| InChI | InChI=1S/2C15H15NO2.C12H10N2/c2*1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h2*3-9,16H,1-2H3,(H,17,18);1-10H/b;;2-1+ |
| InChIKey | YVPBHZFURHYFBP-WXXKFALUSA-N |
| XLogP | 10.14 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |