C38H30Cl4N4O4 — CID 139145966
bis(2-(2,6-dichloro-3-methylanilino)benzoic acid);4-pyridin-4-ylpyridine (PubChem CID 139145966) has the molecular formula C38H30Cl4N4O4 and a molecular weight of 748.49 g/mol. Its IUPAC name is bis(2-(2,6-dichloro-3-methylanilino)benzoic acid);4-pyridin-4-ylpyridine.
| Compound Name | bis(2-(2,6-dichloro-3-methylanilino)benzoic acid);4-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 139145966 |
| Molecular Formula | C38H30Cl4N4O4 |
| Molecular Weight | 748.49 g/mol |
| Exact Mass | 746.10 |
| IUPAC Name | bis(2-(2,6-dichloro-3-methylanilino)benzoic acid);4-pyridin-4-ylpyridine |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)O)c1Cl.Cc1ccc(Cl)c(Nc2ccccc2C(=O)O)c1Cl.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/2C14H11Cl2NO2.C10H8N2/c2*1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h2*2-7,17H,1H3,(H,18,19);1-8H |
| InChIKey | MJALQGRFBMHQER-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.49 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |