C14H12Cl2NNaO3 — CID 23663959
sodium;2-(2,6-dichloro-3-methylanilino)benzoate;hydrate (PubChem CID 23663959) has the molecular formula C14H12Cl2NNaO3 and a molecular weight of 336.15 g/mol. Its IUPAC name is sodium;2-(2,6-dichloro-3-methylanilino)benzoate;hydrate.
| Compound Name | sodium;2-(2,6-dichloro-3-methylanilino)benzoate;hydrate |
|---|---|
| PubChem CID | 23663959 |
| Molecular Formula | C14H12Cl2NNaO3 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | sodium;2-(2,6-dichloro-3-methylanilino)benzoate;hydrate |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)[O-])c1Cl.O.[Na+] |
| InChI | InChI=1S/C14H11Cl2NO2.Na.H2O/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19;;/h2-7,17H,1H3,(H,18,19);;1H2/q;+1;/p-1 |
| InChIKey | QHJLLDJTVQAFAN-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |