C21H27Cl2NO3 — CID 70500245
butane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate (PubChem CID 70500245) has the molecular formula C21H27Cl2NO3 and a molecular weight of 412.36 g/mol. Its IUPAC name is butane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate.
| Compound Name | butane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
|---|---|
| PubChem CID | 70500245 |
| Molecular Formula | C21H27Cl2NO3 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | butane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
| SMILES | CCCC.CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO3.C4H10/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;1-3-4-2/h4-9,20H,3,10H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | ZUQGPCJBHAZNBJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|