C28H29Cl2N3O5 — CID 67132573
ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl 5-methyl-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (PubChem CID 67132573) has the molecular formula C28H29Cl2N3O5 and a molecular weight of 558.46 g/mol. Its IUPAC name is ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl 5-methyl-1H-pyrrolo[3,2-b]pyridine-2-carboxylate.
| Compound Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl 5-methyl-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67132573 |
| Molecular Formula | C28H29Cl2N3O5 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl 5-methyl-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2nc(C)ccc2[nH]1.CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO3.C11H12N2O2/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;1-3-15-11(14)10-6-9-8(13-10)5-4-7(2)12-9/h4-9,20H,3,10H2,1-2H3;4-6,13H,3H2,1-2H3 |
| InChIKey | KUZMRNHWMALAGD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|