C52H63Cl2NO9 — CID 87924025
ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;6-[4-[(E)-2-[3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]ethenyl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 87924025) has the molecular formula C52H63Cl2NO9 and a molecular weight of 916.98 g/mol. Its IUPAC name is ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;6-[4-[(E)-2-[3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]ethenyl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;6-[4-[(E)-2-[3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]ethenyl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87924025 |
| Molecular Formula | C52H63Cl2NO9 |
| Molecular Weight | 916.98 g/mol |
| Exact Mass | 915.39 |
| IUPAC Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;6-[4-[(E)-2-[3-methyl-4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]ethenyl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(/C=C/c2ccc(OCCCCCCOC(=O)C(=C)C)c(C)c2)cc1.CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C35H46O6.C17H17Cl2NO3/c1-27(2)34(36)40-24-12-8-6-10-22-38-32-19-16-30(17-20-32)14-15-31-18-21-33(29(5)26-31)39-23-11-7-9-13-25-41-35(37)28(3)4;1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19/h14-21,26H,1,3,6-13,22-25H2,2,4-5H3;4-9,20H,3,10H2,1-2H3/b15-14+; |
| InChIKey | XFYHVYKFDADVNC-WPDLWGESSA-N |
| XLogP | 13.48 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.98 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|