C22H28Cl2N2O4 — CID 24752851
acetic acid;2-(diethylamino)ethyl 2-(2,6-dichloro-3-methylanilino)benzoate (PubChem CID 24752851) has the molecular formula C22H28Cl2N2O4 and a molecular weight of 455.38 g/mol. Its IUPAC name is acetic acid;2-(diethylamino)ethyl 2-(2,6-dichloro-3-methylanilino)benzoate.
| Compound Name | acetic acid;2-(diethylamino)ethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
|---|---|
| PubChem CID | 24752851 |
| Molecular Formula | C22H28Cl2N2O4 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | acetic acid;2-(diethylamino)ethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
| SMILES | CC(=O)O.CCN(CC)CCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C20H24Cl2N2O2.C2H4O2/c1-4-24(5-2)12-13-26-20(25)15-8-6-7-9-17(15)23-19-16(21)11-10-14(3)18(19)22;1-2(3)4/h6-11,23H,4-5,12-13H2,1-3H3;1H3,(H,3,4) |
| InChIKey | ZVRWZQATSTUFDV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |