C17H23Cl2N3O3 — CID 70150385
azane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate (PubChem CID 70150385) has the molecular formula C17H23Cl2N3O3 and a molecular weight of 388.30 g/mol. Its IUPAC name is azane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate.
| Compound Name | azane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
|---|---|
| PubChem CID | 70150385 |
| Molecular Formula | C17H23Cl2N3O3 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | azane;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
| SMILES | CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl.N.N |
| InChI | InChI=1S/C17H17Cl2NO3.2H3N/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;;/h4-9,20H,3,10H2,1-2H3;2*1H3 |
| InChIKey | QMLCSWIZZXGENJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|