C14H11Cl2NO2 — CID 164516784
6-(2,6-dichloro-3-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (PubChem CID 164516784) has the molecular formula C14H11Cl2NO2 and a molecular weight of 302.11 g/mol. Its IUPAC name is 6-(2,6-dichloro-3-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid.
| Compound Name | 6-(2,6-dichloro-3-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 164516784 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 6-(2,6-dichloro-3-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| SMILES | Cc1ccc(Cl)c(N[13c]2[13cH][13cH][13cH][13cH][13c]2C(=O)O)c1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h2-7,17H,1H3,(H,18,19)/i2+1,3+1,4+1,5+1,9+1,11+1 |
| InChIKey | SBDNJUWAMKYJOX-JREQKAILSA-N |
| XLogP | 4.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |