C33H31Cl2N3O4 — CID 174808608
4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(2,6-dichloro-3-methylanilino)benzoic acid (PubChem CID 174808608) has the molecular formula C33H31Cl2N3O4 and a molecular weight of 604.53 g/mol. Its IUPAC name is 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(2,6-dichloro-3-methylanilino)benzoic acid.
| Compound Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(2,6-dichloro-3-methylanilino)benzoic acid |
|---|---|
| PubChem CID | 174808608 |
| Molecular Formula | C33H31Cl2N3O4 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | 4-butyl-1,2-diphenylpyrazolidine-3,5-dione;2-(2,6-dichloro-3-methylanilino)benzoic acid |
| SMILES | CCCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.Cc1ccc(Cl)c(Nc2ccccc2C(=O)O)c1Cl |
| InChI | InChI=1S/C19H20N2O2.C14H11Cl2NO2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19/h4-13,17H,2-3,14H2,1H3;2-7,17H,1H3,(H,18,19) |
| InChIKey | FNWJQEOGBMQCLN-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|