C19H19Cl2N3O3S — CID 67561255
ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;thiadiazole (PubChem CID 67561255) has the molecular formula C19H19Cl2N3O3S and a molecular weight of 440.35 g/mol. Its IUPAC name is ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;thiadiazole.
| Compound Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;thiadiazole |
|---|---|
| PubChem CID | 67561255 |
| Molecular Formula | C19H19Cl2N3O3S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;thiadiazole |
| SMILES | CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl.c1csnn1 |
| InChI | InChI=1S/C17H17Cl2NO3.C2H2N2S/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;1-2-5-4-3-1/h4-9,20H,3,10H2,1-2H3;1-2H |
| InChIKey | WRSLIEGNCQLMTR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|