C23H28Cl2N2O7 — CID 70153226
ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl carbamate;prop-2-enoic acid (PubChem CID 70153226) has the molecular formula C23H28Cl2N2O7 and a molecular weight of 515.39 g/mol. Its IUPAC name is ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl carbamate;prop-2-enoic acid.
| Compound Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl carbamate;prop-2-enoic acid |
|---|---|
| PubChem CID | 70153226 |
| Molecular Formula | C23H28Cl2N2O7 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;ethyl carbamate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCOC(N)=O.CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO3.C3H7NO2.C3H4O2/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;1-2-6-3(4)5;1-2-3(4)5/h4-9,20H,3,10H2,1-2H3;2H2,1H3,(H2,4,5);2H,1H2,(H,4,5) |
| InChIKey | VDINSNASJYDASU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|