C27H29Cl3N2O5 — CID 66619944
ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;propan-2-yl N-(3-chlorophenyl)carbamate (PubChem CID 66619944) has the molecular formula C27H29Cl3N2O5 and a molecular weight of 567.90 g/mol. Its IUPAC name is ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;propan-2-yl N-(3-chlorophenyl)carbamate.
| Compound Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;propan-2-yl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 66619944 |
| Molecular Formula | C27H29Cl3N2O5 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate;propan-2-yl N-(3-chlorophenyl)carbamate |
| SMILES | CC(C)OC(=O)Nc1cccc(Cl)c1.CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO3.C10H12ClNO2/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;1-7(2)14-10(13)12-9-5-3-4-8(11)6-9/h4-9,20H,3,10H2,1-2H3;3-7H,1-2H3,(H,12,13) |
| InChIKey | OZZRSOLLSWKEOY-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|