C24H19BrCl3FN2O3 — CID 135371636
3-bromo-6-chloro-2-fluorobenzonitrile;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate (PubChem CID 135371636) has the molecular formula C24H19BrCl3FN2O3 and a molecular weight of 588.69 g/mol. Its IUPAC name is 3-bromo-6-chloro-2-fluorobenzonitrile;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate.
| Compound Name | 3-bromo-6-chloro-2-fluorobenzonitrile;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
|---|---|
| PubChem CID | 135371636 |
| Molecular Formula | C24H19BrCl3FN2O3 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 585.96 |
| IUPAC Name | 3-bromo-6-chloro-2-fluorobenzonitrile;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
| SMILES | CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl.N#Cc1c(Cl)ccc(Br)c1F |
| InChI | InChI=1S/C17H17Cl2NO3.C7H2BrClFN/c1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19;8-5-1-2-6(9)4(3-11)7(5)10/h4-9,20H,3,10H2,1-2H3;1-2H |
| InChIKey | UAWCZCPNXIEPAZ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|