C39H41Cl3N4O6 — CID 166691986
N-[1-(4-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate (PubChem CID 166691986) has the molecular formula C39H41Cl3N4O6 and a molecular weight of 768.14 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate.
| Compound Name | N-[1-(4-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
|---|---|
| PubChem CID | 166691986 |
| Molecular Formula | C39H41Cl3N4O6 |
| Molecular Weight | 768.14 g/mol |
| Exact Mass | 766.21 |
| IUPAC Name | N-[1-(4-aminophenyl)-2-(tert-butylamino)-2-oxoethyl]-N-(3-chloro-4-methoxyphenyl)prop-2-ynamide;ethoxymethyl 2-(2,6-dichloro-3-methylanilino)benzoate |
| SMILES | C#CC(=O)N(c1ccc(OC)c(Cl)c1)C(C(=O)NC(C)(C)C)c1ccc(N)cc1.CCOCOC(=O)c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C22H24ClN3O3.C17H17Cl2NO3/c1-6-19(27)26(16-11-12-18(29-5)17(23)13-16)20(21(28)25-22(2,3)4)14-7-9-15(24)10-8-14;1-3-22-10-23-17(21)12-6-4-5-7-14(12)20-16-13(18)9-8-11(2)15(16)19/h1,7-13,20H,24H2,2-5H3,(H,25,28);4-9,20H,3,10H2,1-2H3 |
| InChIKey | RWPOBCXKHNSJHB-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.14 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|