C20H24Cl2N2O2 — CID 175333784
2-[2-(2,6-dichloro-3-methylanilino)ethyl-ethylamino]ethyl benzoate (PubChem CID 175333784) has the molecular formula C20H24Cl2N2O2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-[2-(2,6-dichloro-3-methylanilino)ethyl-ethylamino]ethyl benzoate.
| Compound Name | 2-[2-(2,6-dichloro-3-methylanilino)ethyl-ethylamino]ethyl benzoate |
|---|---|
| PubChem CID | 175333784 |
| Molecular Formula | C20H24Cl2N2O2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[2-(2,6-dichloro-3-methylanilino)ethyl-ethylamino]ethyl benzoate |
| SMILES | CCN(CCNc1c(Cl)ccc(C)c1Cl)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24Cl2N2O2/c1-3-24(13-14-26-20(25)16-7-5-4-6-8-16)12-11-23-19-17(21)10-9-15(2)18(19)22/h4-10,23H,3,11-14H2,1-2H3 |
| InChIKey | GLXOAGYZOOUIDR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |