C28H30O5 — CID 58693221
(4-methylnaphthalen-1-yl) 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate (PubChem CID 58693221) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (4-methylnaphthalen-1-yl) 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | (4-methylnaphthalen-1-yl) 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 58693221 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (4-methylnaphthalen-1-yl) 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H30O5/c1-20(2)27(29)32-19-9-5-4-8-18-31-23-15-13-22(14-16-23)28(30)33-26-17-12-21(3)24-10-6-7-11-25(24)26/h6-7,10-17H,1,4-5,8-9,18-19H2,2-3H3 |
| InChIKey | VTWOIIGUWIDVBW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|