C33H31FN2O5 — CID 155899398
[4-[(4-fluorophenyl)diazenyl]naphthalen-1-yl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate (PubChem CID 155899398) has the molecular formula C33H31FN2O5 and a molecular weight of 554.62 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)diazenyl]naphthalen-1-yl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | [4-[(4-fluorophenyl)diazenyl]naphthalen-1-yl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 155899398 |
| Molecular Formula | C33H31FN2O5 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | [4-[(4-fluorophenyl)diazenyl]naphthalen-1-yl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H31FN2O5/c1-23(2)32(37)40-22-8-4-3-7-21-39-27-17-11-24(12-18-27)33(38)41-31-20-19-30(28-9-5-6-10-29(28)31)36-35-26-15-13-25(34)14-16-26/h5-6,9-20H,1,3-4,7-8,21-22H2,2H3/b36-35+ |
| InChIKey | JJYJVGDMTJURCO-ULDVOPSXSA-N |
| XLogP | 8.67 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|