C44H42N4O5 — CID 118439191
[4-[[[4-[(4-aminonaphthalen-1-yl)diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate (PubChem CID 118439191) has the molecular formula C44H42N4O5 and a molecular weight of 706.84 g/mol. Its IUPAC name is [4-[[[4-[(4-aminonaphthalen-1-yl)diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate.
| Compound Name | [4-[[[4-[(4-aminonaphthalen-1-yl)diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
|---|---|
| PubChem CID | 118439191 |
| Molecular Formula | C44H42N4O5 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.32 |
| IUPAC Name | [4-[[[4-[(4-aminonaphthalen-1-yl)diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-[6-(2-methylprop-2-enoyloxy)hexoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(CNc3ccc(/N=N/c4ccc(N)c5ccccc45)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C44H42N4O5/c1-30(2)43(49)52-28-10-4-3-9-27-51-33-21-17-32(18-22-33)44(50)53-34-19-15-31(16-20-34)29-46-40-25-26-42(38-14-8-7-13-37(38)40)48-47-41-24-23-39(45)35-11-5-6-12-36(35)41/h5-8,11-26,46H,1,3-4,9-10,27-29,45H2,2H3/b48-47+ |
| InChIKey | STUOBZHZTITTMZ-QJGAVIKSSA-N |
| XLogP | 10.88 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|