C52H53N3O7 — CID 58693228
(4-butoxyphenyl) 4-[[4-[[4-[2-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-2-oxoethyl]phenyl]methylamino]naphthalen-1-yl]diazenyl]benzoate (PubChem CID 58693228) has the molecular formula C52H53N3O7 and a molecular weight of 832.01 g/mol. Its IUPAC name is (4-butoxyphenyl) 4-[[4-[[4-[2-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-2-oxoethyl]phenyl]methylamino]naphthalen-1-yl]diazenyl]benzoate.
| Compound Name | (4-butoxyphenyl) 4-[[4-[[4-[2-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-2-oxoethyl]phenyl]methylamino]naphthalen-1-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 58693228 |
| Molecular Formula | C52H53N3O7 |
| Molecular Weight | 832.01 g/mol |
| Exact Mass | 831.39 |
| IUPAC Name | (4-butoxyphenyl) 4-[[4-[[4-[2-[4-[6-(2-methylprop-2-enoyloxy)hexoxy]phenyl]-2-oxoethyl]phenyl]methylamino]naphthalen-1-yl]diazenyl]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(C(=O)Cc2ccc(CNc3ccc(/N=N/c4ccc(C(=O)Oc5ccc(OCCCC)cc5)cc4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C52H53N3O7/c1-4-5-32-59-44-26-28-45(29-27-44)62-52(58)41-18-22-42(23-19-41)54-55-49-31-30-48(46-12-8-9-13-47(46)49)53-36-39-16-14-38(15-17-39)35-50(56)40-20-24-43(25-21-40)60-33-10-6-7-11-34-61-51(57)37(2)3/h8-9,12-31,53H,2,4-7,10-11,32-36H2,1,3H3/b55-54+ |
| InChIKey | GAAZCLVUESLJAU-SBZZGWGOSA-N |
| XLogP | 12.75 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.01 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|