C49H49N7O4 — CID 58693234
[4-[[[4-[[2,5-dimethyl-4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-(7-prop-2-enoyloxyheptyl)benzoate (PubChem CID 58693234) has the molecular formula C49H49N7O4 and a molecular weight of 799.98 g/mol. Its IUPAC name is [4-[[[4-[[2,5-dimethyl-4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-(7-prop-2-enoyloxyheptyl)benzoate.
| Compound Name | [4-[[[4-[[2,5-dimethyl-4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-(7-prop-2-enoyloxyheptyl)benzoate |
|---|---|
| PubChem CID | 58693234 |
| Molecular Formula | C49H49N7O4 |
| Molecular Weight | 799.98 g/mol |
| Exact Mass | 799.38 |
| IUPAC Name | [4-[[[4-[[2,5-dimethyl-4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]naphthalen-1-yl]amino]methyl]phenyl] 4-(7-prop-2-enoyloxyheptyl)benzoate |
| SMILES | C=CC(=O)OCCCCCCCc1ccc(C(=O)Oc2ccc(CNc3ccc(/N=N/c4cc(C)c(/N=N/c5ccc(/N=N/C)cc5)cc4C)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C49H49N7O4/c1-5-48(57)59-30-12-8-6-7-9-13-36-16-20-38(21-17-36)49(58)60-41-26-18-37(19-27-41)33-51-44-28-29-45(43-15-11-10-14-42(43)44)54-56-47-32-34(2)46(31-35(47)3)55-53-40-24-22-39(23-25-40)52-50-4/h5,10-11,14-29,31-32,51H,1,6-9,12-13,30,33H2,2-4H3/b52-50+,55-53+,56-54+ |
| InChIKey | MXYOPVZRJSKYIS-PKHQUVCRSA-N |
| XLogP | 14.05 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.98 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|