C35H40O6S — CID 90266091
[4-(4-heptylphenoxy)carbonylphenyl] 3-methyl-4-(4-prop-2-enoyloxybutylsulfanyl)benzoate (PubChem CID 90266091) has the molecular formula C35H40O6S and a molecular weight of 588.77 g/mol. Its IUPAC name is [4-(4-heptylphenoxy)carbonylphenyl] 3-methyl-4-(4-prop-2-enoyloxybutylsulfanyl)benzoate.
| Compound Name | [4-(4-heptylphenoxy)carbonylphenyl] 3-methyl-4-(4-prop-2-enoyloxybutylsulfanyl)benzoate |
|---|---|
| PubChem CID | 90266091 |
| Molecular Formula | C35H40O6S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | [4-(4-heptylphenoxy)carbonylphenyl] 3-methyl-4-(4-prop-2-enoyloxybutylsulfanyl)benzoate |
| SMILES | C=CC(=O)OCCCCSc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(CCCCCCC)cc3)cc2)cc1C |
| InChI | InChI=1S/C35H40O6S/c1-4-6-7-8-9-12-27-13-18-30(19-14-27)40-34(37)28-15-20-31(21-16-28)41-35(38)29-17-22-32(26(3)25-29)42-24-11-10-23-39-33(36)5-2/h5,13-22,25H,2,4,6-12,23-24H2,1,3H3 |
| InChIKey | MAQXWXFYBHDTQP-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|