C34H41NO5 — CID 19809920
[4-(5-ethyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate (PubChem CID 19809920) has the molecular formula C34H41NO5 and a molecular weight of 543.70 g/mol. Its IUPAC name is [4-(5-ethyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate.
| Compound Name | [4-(5-ethyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate |
|---|---|
| PubChem CID | 19809920 |
| Molecular Formula | C34H41NO5 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [4-(5-ethyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(CC)cn3)cc2)cc1 |
| InChI | InChI=1S/C34H41NO5/c1-4-27-13-22-32(35-25-27)28-14-20-31(21-15-28)40-34(37)29-16-18-30(19-17-29)38-23-11-9-7-5-6-8-10-12-24-39-33(36)26(2)3/h13-22,25H,2,4-12,23-24H2,1,3H3 |
| InChIKey | OCYRTZUHSQRMIF-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|