C39H51NO5 — CID 19809883
[4-(5-heptyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate (PubChem CID 19809883) has the molecular formula C39H51NO5 and a molecular weight of 613.84 g/mol. Its IUPAC name is [4-(5-heptyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate.
| Compound Name | [4-(5-heptyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate |
|---|---|
| PubChem CID | 19809883 |
| Molecular Formula | C39H51NO5 |
| Molecular Weight | 613.84 g/mol |
| Exact Mass | 613.38 |
| IUPAC Name | [4-(5-heptyl-2-pyridinyl)phenyl] 4-[10-(2-methylprop-2-enoyloxy)decoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(CCCCCCC)cn3)cc2)cc1 |
| InChI | InChI=1S/C39H51NO5/c1-4-5-6-11-14-17-32-18-27-37(40-30-32)33-19-25-36(26-20-33)45-39(42)34-21-23-35(24-22-34)43-28-15-12-9-7-8-10-13-16-29-44-38(41)31(2)3/h18-27,30H,2,4-17,28-29H2,1,3H3 |
| InChIKey | IWIFSMRWIPLPNG-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.84 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|