About [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate
[4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate (PubChem CID 139624169) has the molecular formula C36H49NO3
and a molecular weight of 543.79 g/mol. Its IUPAC name is [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate.
Molecular Properties
| Compound Name | [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate |
| PubChem CID | 139624169 |
| Molecular Formula | C36H49NO3 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCCCC)cc3)cc2)nc1 |
| InChI | InChI=1S/C36H49NO3/c1-3-5-7-9-11-12-14-16-28-39-34-26-27-35(37-29-34)31-22-24-33(25-23-31)40-36(38)32-20-18-30(19-21-32)17-15-13-10-8-6-4-2/h18-27,29H,3-17,28H2,1-2H3 |
| InChIKey | XDRNJPMWFUTRJX-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate?
The IUPAC name of [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate (CID 139624169) is [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate.
What is the SMILES notation for [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate?
The canonical SMILES for [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate is CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCCCC)cc3)cc2)nc1.
What is the InChIKey of [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate?
The InChIKey is XDRNJPMWFUTRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H49NO3/c1-3-5-7-9-11-12-14-16-28-39-34-26-27-35(37-29-34)31-22-24-33(25-23-31)40-36(38)32-20-18-30(19-21-32)17-15-13-10-8-6-4-2/h18-27,29H,3-17,28H2,1-2H3.
What are the key properties of [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate?
[4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate has a molecular weight of 543.79 g/mol, XLogP of 10.39, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-decoxy-2-pyridinyl)phenyl] 4-octylbenzoate is sourced from PubChem (CID 139624169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).