About [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate
[6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate (PubChem CID 139624157) has the molecular formula C28H33NO3
and a molecular weight of 431.58 g/mol. Its IUPAC name is [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate.
Molecular Properties
| Compound Name | [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate |
| PubChem CID | 139624157 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate |
| SMILES | CCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H33NO3/c1-3-5-7-8-20-31-25-16-14-23(15-17-25)27-19-18-26(21-29-27)32-28(30)24-12-10-22(11-13-24)9-6-4-2/h10-19,21H,3-9,20H2,1-2H3 |
| InChIKey | VPDJVNCDOXHZBN-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate?
The IUPAC name of [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate (CID 139624157) is [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate.
What is the SMILES notation for [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate?
The canonical SMILES for [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate is CCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCCC)cc3)cn2)cc1.
What is the InChIKey of [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate?
The InChIKey is VPDJVNCDOXHZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33NO3/c1-3-5-7-8-20-31-25-16-14-23(15-17-25)27-19-18-26(21-29-27)32-28(30)24-12-10-22(11-13-24)9-6-4-2/h10-19,21H,3-9,20H2,1-2H3.
What are the key properties of [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate?
[6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate has a molecular weight of 431.58 g/mol, XLogP of 7.27, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-hexoxyphenyl)-3-pyridinyl] 4-butylbenzoate is sourced from PubChem (CID 139624157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).