About [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate
[6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate (PubChem CID 139624084) has the molecular formula C31H39NO3
and a molecular weight of 473.66 g/mol. Its IUPAC name is [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate.
Molecular Properties
| Compound Name | [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate |
| PubChem CID | 139624084 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate |
| SMILES | CCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCC)cc3)cn2)cc1 |
| InChI | InChI=1S/C31H39NO3/c1-3-5-7-9-11-23-34-28-19-17-26(18-20-28)30-22-21-29(24-32-30)35-31(33)27-15-13-25(14-16-27)12-10-8-6-4-2/h13-22,24H,3-12,23H2,1-2H3 |
| InChIKey | CNARGTRPEZVPRL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate?
The IUPAC name of [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate (CID 139624084) is [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate.
What is the SMILES notation for [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate?
The canonical SMILES for [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate is CCCCCCCOc1ccc(-c2ccc(OC(=O)c3ccc(CCCCCC)cc3)cn2)cc1.
What is the InChIKey of [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate?
The InChIKey is CNARGTRPEZVPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H39NO3/c1-3-5-7-9-11-23-34-28-19-17-26(18-20-28)30-22-21-29(24-32-30)35-31(33)27-15-13-25(14-16-27)12-10-8-6-4-2/h13-22,24H,3-12,23H2,1-2H3.
What are the key properties of [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate?
[6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate has a molecular weight of 473.66 g/mol, XLogP of 8.44, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-heptoxyphenyl)-3-pyridinyl] 4-hexylbenzoate is sourced from PubChem (CID 139624084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).