C37H47NO5 — CID 19809997
[4-(5-hexyl-2-pyridinyl)phenyl] 4-[9-(2-methylprop-2-enoyloxy)nonoxy]benzoate (PubChem CID 19809997) has the molecular formula C37H47NO5 and a molecular weight of 585.79 g/mol. Its IUPAC name is [4-(5-hexyl-2-pyridinyl)phenyl] 4-[9-(2-methylprop-2-enoyloxy)nonoxy]benzoate.
| Compound Name | [4-(5-hexyl-2-pyridinyl)phenyl] 4-[9-(2-methylprop-2-enoyloxy)nonoxy]benzoate |
|---|---|
| PubChem CID | 19809997 |
| Molecular Formula | C37H47NO5 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | [4-(5-hexyl-2-pyridinyl)phenyl] 4-[9-(2-methylprop-2-enoyloxy)nonoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(CCCCCC)cn3)cc2)cc1 |
| InChI | InChI=1S/C37H47NO5/c1-4-5-6-12-15-30-16-25-35(38-28-30)31-17-23-34(24-18-31)43-37(40)32-19-21-33(22-20-32)41-26-13-10-8-7-9-11-14-27-42-36(39)29(2)3/h16-25,28H,2,4-15,26-27H2,1,3H3 |
| InChIKey | ZRAGHQGCABWACU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|