C13H11Cl2NS — CID 137454964
2-(2,6-dichloro-3-methylanilino)benzenethiol (PubChem CID 137454964) has the molecular formula C13H11Cl2NS and a molecular weight of 284.21 g/mol. Its IUPAC name is 2-(2,6-dichloro-3-methylanilino)benzenethiol.
| Compound Name | 2-(2,6-dichloro-3-methylanilino)benzenethiol |
|---|---|
| PubChem CID | 137454964 |
| Molecular Formula | C13H11Cl2NS |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-(2,6-dichloro-3-methylanilino)benzenethiol |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2S)c1Cl |
| InChI | InChI=1S/C13H11Cl2NS/c1-8-6-7-9(14)13(12(8)15)16-10-4-2-3-5-11(10)17/h2-7,16-17H,1H3 |
| InChIKey | CJQMYBKQFJPZCE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|