C15H15Cl2NO3P- — CID 149046188
[2-(2,6-dichloro-3-methylanilino)phenyl]-ethoxyphosphinate (PubChem CID 149046188) has the molecular formula C15H15Cl2NO3P- and a molecular weight of 359.17 g/mol. Its IUPAC name is [2-(2,6-dichloro-3-methylanilino)phenyl]-ethoxyphosphinate.
| Compound Name | [2-(2,6-dichloro-3-methylanilino)phenyl]-ethoxyphosphinate |
|---|---|
| PubChem CID | 149046188 |
| Molecular Formula | C15H15Cl2NO3P- |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | [2-(2,6-dichloro-3-methylanilino)phenyl]-ethoxyphosphinate |
| SMILES | CCOP(=O)([O-])c1ccccc1Nc1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C15H16Cl2NO3P/c1-3-21-22(19,20)13-7-5-4-6-12(13)18-15-11(16)9-8-10(2)14(15)17/h4-9,18H,3H2,1-2H3,(H,19,20)/p-1 |
| InChIKey | QIQLWNIOOFOAMS-UHFFFAOYSA-M |
| XLogP | 4.26 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|