C15H15NO2 — CID 175757896
deuterio 2-(2,3-dimethylanilino)benzoate (PubChem CID 175757896) has the molecular formula C15H15NO2 and a molecular weight of 242.30 g/mol. Its IUPAC name is deuterio 2-(2,3-dimethylanilino)benzoate.
| Compound Name | deuterio 2-(2,3-dimethylanilino)benzoate |
|---|---|
| PubChem CID | 175757896 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | deuterio 2-(2,3-dimethylanilino)benzoate |
| SMILES | [2H]OC(=O)c1ccccc1Nc1cccc(C)c1C |
| InChI | InChI=1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18)/i/hD |
| InChIKey | HYYBABOKPJLUIN-DYCDLGHISA-N |
| XLogP | 3.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |