C15H14CuNO2+ — CID 135564277
copper 2-(2,3-dimethylanilino)benzoate (PubChem CID 135564277) has the molecular formula C15H14CuNO2+ and a molecular weight of 303.83 g/mol. Its IUPAC name is copper 2-(2,3-dimethylanilino)benzoate.
| Compound Name | copper 2-(2,3-dimethylanilino)benzoate |
|---|---|
| PubChem CID | 135564277 |
| Molecular Formula | C15H14CuNO2+ |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | copper 2-(2,3-dimethylanilino)benzoate |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)[O-])c1C.[Cu+2] |
| InChI | InChI=1S/C15H15NO2.Cu/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;/h3-9,16H,1-2H3,(H,17,18);/q;+2/p-1 |
| InChIKey | GUYDGUDDNNGCAD-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |