C16H16NNaO2 — CID 23680214
sodium 2-(2,3-dimethylanilino)-3-methylbenzoate (PubChem CID 23680214) has the molecular formula C16H16NNaO2 and a molecular weight of 277.30 g/mol. Its IUPAC name is sodium 2-(2,3-dimethylanilino)-3-methylbenzoate.
| Compound Name | sodium 2-(2,3-dimethylanilino)-3-methylbenzoate |
|---|---|
| PubChem CID | 23680214 |
| Molecular Formula | C16H16NNaO2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | sodium 2-(2,3-dimethylanilino)-3-methylbenzoate |
| SMILES | Cc1cccc(Nc2c(C)cccc2C(=O)[O-])c1C.[Na+] |
| InChI | InChI=1S/C16H17NO2.Na/c1-10-6-5-9-14(12(10)3)17-15-11(2)7-4-8-13(15)16(18)19;/h4-9,17H,1-3H3,(H,18,19);/q;+1/p-1 |
| InChIKey | ZVCMWMBGXPYXJE-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |