C13H8F2NO2- — CID 163199732
2-(2,6-difluoroanilino)benzoate (PubChem CID 163199732) has the molecular formula C13H8F2NO2- and a molecular weight of 248.21 g/mol. Its IUPAC name is 2-(2,6-difluoroanilino)benzoate.
| Compound Name | 2-(2,6-difluoroanilino)benzoate |
|---|---|
| PubChem CID | 163199732 |
| Molecular Formula | C13H8F2NO2- |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(2,6-difluoroanilino)benzoate |
| SMILES | O=C([O-])c1ccccc1Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H9F2NO2/c14-9-5-3-6-10(15)12(9)16-11-7-2-1-4-8(11)13(17)18/h1-7,16H,(H,17,18)/p-1 |
| InChIKey | MDPGGSSSOXCRRV-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |