C16H14NO3- — CID 6950917
2-[(2,3-dimethylphenyl)carbamoyl]benzoate (PubChem CID 6950917) has the molecular formula C16H14NO3- and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)carbamoyl]benzoate.
| Compound Name | 2-[(2,3-dimethylphenyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 6950917 |
| Molecular Formula | C16H14NO3- |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[(2,3-dimethylphenyl)carbamoyl]benzoate |
| SMILES | Cc1cccc(NC(=O)c2ccccc2C(=O)[O-])c1C |
| InChI | InChI=1S/C16H15NO3/c1-10-6-5-9-14(11(10)2)17-15(18)12-7-3-4-8-13(12)16(19)20/h3-9H,1-2H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | NANJTVUHWVLWBC-UHFFFAOYSA-M |
| XLogP | 1.92 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |