C17H19NO — CID 7923827
N-(2-ethylphenyl)-2,3-dimethylbenzamide (PubChem CID 7923827) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,3-dimethylbenzamide.
| Compound Name | N-(2-ethylphenyl)-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 7923827 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-(2-ethylphenyl)-2,3-dimethylbenzamide |
| SMILES | CCc1ccccc1NC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C17H19NO/c1-4-14-9-5-6-11-16(14)18-17(19)15-10-7-8-12(2)13(15)3/h5-11H,4H2,1-3H3,(H,18,19) |
| InChIKey | HOEDFSRSXBDYDM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |