C15H13F2NO — CID 62650811
N-(2-ethylphenyl)-2,3-difluorobenzamide (PubChem CID 62650811) has the molecular formula C15H13F2NO and a molecular weight of 261.27 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,3-difluorobenzamide.
| Compound Name | N-(2-ethylphenyl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 62650811 |
| Molecular Formula | C15H13F2NO |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(2-ethylphenyl)-2,3-difluorobenzamide |
| SMILES | CCc1ccccc1NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C15H13F2NO/c1-2-10-6-3-4-9-13(10)18-15(19)11-7-5-8-12(16)14(11)17/h3-9H,2H2,1H3,(H,18,19) |
| InChIKey | WSSQXWNGWYGWSZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |