2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride

C13H8F3NO3S — CID 116814244

IUPAC2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride
SMILESO=C(Nc1ccccc1S(=O)(=O)F)c1cccc(F)c1F
InChIInChI=1S/C13H8F3NO3S/c14-9-5-3-4-8(12(9)15)13(18)17-10-6-1-2-7-11(10)21(16,19)20/h1-7H,(H,17,18)
InChIKeyCNUHOJOHJNTHAA-UHFFFAOYSA-N
MW315.27 g/mol
LogP2.88
Rot. Bonds3

About 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride

2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride (PubChem CID 116814244) has the molecular formula C13H8F3NO3S and a molecular weight of 315.27 g/mol. Its IUPAC name is 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride.

Molecular Properties

Compound Name2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride
PubChem CID116814244
Molecular FormulaC13H8F3NO3S
Molecular Weight315.27 g/mol
Exact Mass315.02
IUPAC Name2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride
SMILESO=C(Nc1ccccc1S(=O)(=O)F)c1cccc(F)c1F
InChIInChI=1S/C13H8F3NO3S/c14-9-5-3-4-8(12(9)15)13(18)17-10-6-1-2-7-11(10)21(16,19)20/h1-7H,(H,17,18)
InChIKeyCNUHOJOHJNTHAA-UHFFFAOYSA-N
XLogP2.88
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.27
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride?
The IUPAC name of 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride (CID 116814244) is 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride.
What is the SMILES notation for 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride?
The canonical SMILES for 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride is O=C(Nc1ccccc1S(=O)(=O)F)c1cccc(F)c1F.
What is the InChIKey of 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride?
The InChIKey is CNUHOJOHJNTHAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3NO3S/c14-9-5-3-4-8(12(9)15)13(18)17-10-6-1-2-7-11(10)21(16,19)20/h1-7H,(H,17,18).
What are the key properties of 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride?
2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride has a molecular weight of 315.27 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride is sourced from PubChem (CID 116814244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).