C13H8F3NO3S — CID 116814244
2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride (PubChem CID 116814244) has the molecular formula C13H8F3NO3S and a molecular weight of 315.27 g/mol. Its IUPAC name is 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride.
| Compound Name | 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116814244 |
| Molecular Formula | C13H8F3NO3S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[(2,3-difluorobenzoyl)amino]benzenesulfonyl fluoride |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)F)c1cccc(F)c1F |
| InChI | InChI=1S/C13H8F3NO3S/c14-9-5-3-4-8(12(9)15)13(18)17-10-6-1-2-7-11(10)21(16,19)20/h1-7H,(H,17,18) |
| InChIKey | CNUHOJOHJNTHAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |