C14H12FNO4S — CID 116813960
2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride (PubChem CID 116813960) has the molecular formula C14H12FNO4S and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride.
| Compound Name | 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 116813960 |
| Molecular Formula | C14H12FNO4S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2S(=O)(=O)F)c(O)c1 |
| InChI | InChI=1S/C14H12FNO4S/c1-9-6-7-10(12(17)8-9)14(18)16-11-4-2-3-5-13(11)21(15,19)20/h2-8,17H,1H3,(H,16,18) |
| InChIKey | RMUOHQHWKWFXQM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |