2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride

C14H12FNO4S — CID 116813960

IUPAC2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride
SMILESCc1ccc(C(=O)Nc2ccccc2S(=O)(=O)F)c(O)c1
InChIInChI=1S/C14H12FNO4S/c1-9-6-7-10(12(17)8-9)14(18)16-11-4-2-3-5-13(11)21(15,19)20/h2-8,17H,1H3,(H,16,18)
InChIKeyRMUOHQHWKWFXQM-UHFFFAOYSA-N
MW309.32 g/mol
LogP2.61
Rot. Bonds3

About 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride

2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride (PubChem CID 116813960) has the molecular formula C14H12FNO4S and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride.

Molecular Properties

Compound Name2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride
PubChem CID116813960
Molecular FormulaC14H12FNO4S
Molecular Weight309.32 g/mol
Exact Mass309.05
IUPAC Name2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride
SMILESCc1ccc(C(=O)Nc2ccccc2S(=O)(=O)F)c(O)c1
InChIInChI=1S/C14H12FNO4S/c1-9-6-7-10(12(17)8-9)14(18)16-11-4-2-3-5-13(11)21(15,19)20/h2-8,17H,1H3,(H,16,18)
InChIKeyRMUOHQHWKWFXQM-UHFFFAOYSA-N
XLogP2.61
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.32
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride?
The IUPAC name of 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride (CID 116813960) is 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride.
What is the SMILES notation for 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride?
The canonical SMILES for 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride is Cc1ccc(C(=O)Nc2ccccc2S(=O)(=O)F)c(O)c1.
What is the InChIKey of 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride?
The InChIKey is RMUOHQHWKWFXQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO4S/c1-9-6-7-10(12(17)8-9)14(18)16-11-4-2-3-5-13(11)21(15,19)20/h2-8,17H,1H3,(H,16,18).
What are the key properties of 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride?
2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride has a molecular weight of 309.32 g/mol, XLogP of 2.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-4-methylbenzoyl)amino]benzenesulfonyl fluoride is sourced from PubChem (CID 116813960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).