2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride

C14H11BrFNO3S — CID 116814224

IUPAC2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride
SMILESCc1cc(Br)cc(C(=O)Nc2ccccc2S(=O)(=O)F)c1
InChIInChI=1S/C14H11BrFNO3S/c1-9-6-10(8-11(15)7-9)14(18)17-12-4-2-3-5-13(12)21(16,19)20/h2-8H,1H3,(H,17,18)
InChIKeyQCQJYJBXMQTCDA-UHFFFAOYSA-N
MW372.22 g/mol
LogP3.67
Rot. Bonds3

About 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride

2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride (PubChem CID 116814224) has the molecular formula C14H11BrFNO3S and a molecular weight of 372.22 g/mol. Its IUPAC name is 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride.

Molecular Properties

Compound Name2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride
PubChem CID116814224
Molecular FormulaC14H11BrFNO3S
Molecular Weight372.22 g/mol
Exact Mass370.96
IUPAC Name2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride
SMILESCc1cc(Br)cc(C(=O)Nc2ccccc2S(=O)(=O)F)c1
InChIInChI=1S/C14H11BrFNO3S/c1-9-6-10(8-11(15)7-9)14(18)17-12-4-2-3-5-13(12)21(16,19)20/h2-8H,1H3,(H,17,18)
InChIKeyQCQJYJBXMQTCDA-UHFFFAOYSA-N
XLogP3.67
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500372.22
LogP ≤ 53.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride?
The IUPAC name of 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride (CID 116814224) is 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride.
What is the SMILES notation for 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride?
The canonical SMILES for 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride is Cc1cc(Br)cc(C(=O)Nc2ccccc2S(=O)(=O)F)c1.
What is the InChIKey of 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride?
The InChIKey is QCQJYJBXMQTCDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrFNO3S/c1-9-6-10(8-11(15)7-9)14(18)17-12-4-2-3-5-13(12)21(16,19)20/h2-8H,1H3,(H,17,18).
What are the key properties of 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride?
2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride has a molecular weight of 372.22 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-bromo-5-methylbenzoyl)amino]benzenesulfonyl fluoride is sourced from PubChem (CID 116814224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).