2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride

C13H8BrClFNO3S — CID 116814035

IUPAC2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride
SMILESO=C(Nc1ccccc1S(=O)(=O)F)c1ccc(Br)cc1Cl
InChIInChI=1S/C13H8BrClFNO3S/c14-8-5-6-9(10(15)7-8)13(18)17-11-3-1-2-4-12(11)21(16,19)20/h1-7H,(H,17,18)
InChIKeyIAVXXBCUFGPPOY-UHFFFAOYSA-N
MW392.63 g/mol
LogP4.01
Rot. Bonds3

About 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride

2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride (PubChem CID 116814035) has the molecular formula C13H8BrClFNO3S and a molecular weight of 392.63 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride.

Molecular Properties

Compound Name2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride
PubChem CID116814035
Molecular FormulaC13H8BrClFNO3S
Molecular Weight392.63 g/mol
Exact Mass390.91
IUPAC Name2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride
SMILESO=C(Nc1ccccc1S(=O)(=O)F)c1ccc(Br)cc1Cl
InChIInChI=1S/C13H8BrClFNO3S/c14-8-5-6-9(10(15)7-8)13(18)17-11-3-1-2-4-12(11)21(16,19)20/h1-7H,(H,17,18)
InChIKeyIAVXXBCUFGPPOY-UHFFFAOYSA-N
XLogP4.01
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500392.63
LogP ≤ 54.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride?
The IUPAC name of 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride (CID 116814035) is 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride.
What is the SMILES notation for 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride?
The canonical SMILES for 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride is O=C(Nc1ccccc1S(=O)(=O)F)c1ccc(Br)cc1Cl.
What is the InChIKey of 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride?
The InChIKey is IAVXXBCUFGPPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrClFNO3S/c14-8-5-6-9(10(15)7-8)13(18)17-11-3-1-2-4-12(11)21(16,19)20/h1-7H,(H,17,18).
What are the key properties of 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride?
2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride has a molecular weight of 392.63 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2-chlorobenzoyl)amino]benzenesulfonyl fluoride is sourced from PubChem (CID 116814035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).