C21H15Cl2NO7S — CID 59759944
methyl 4-chloro-2-[2-[(4-chloro-2-hydroxybenzoyl)amino]phenyl]sulfonyloxybenzoate (PubChem CID 59759944) has the molecular formula C21H15Cl2NO7S and a molecular weight of 496.32 g/mol. Its IUPAC name is methyl 4-chloro-2-[2-[(4-chloro-2-hydroxybenzoyl)amino]phenyl]sulfonyloxybenzoate.
| Compound Name | methyl 4-chloro-2-[2-[(4-chloro-2-hydroxybenzoyl)amino]phenyl]sulfonyloxybenzoate |
|---|---|
| PubChem CID | 59759944 |
| Molecular Formula | C21H15Cl2NO7S |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | methyl 4-chloro-2-[2-[(4-chloro-2-hydroxybenzoyl)amino]phenyl]sulfonyloxybenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1OS(=O)(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C21H15Cl2NO7S/c1-30-21(27)15-9-7-13(23)11-18(15)31-32(28,29)19-5-3-2-4-16(19)24-20(26)14-8-6-12(22)10-17(14)25/h2-11,25H,1H3,(H,24,26) |
| InChIKey | XRHZEWXTMPMSNC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|