C14H10Br2ClNO3 — CID 103414724
4-chloro-N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide (PubChem CID 103414724) has the molecular formula C14H10Br2ClNO3 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103414724 |
| Molecular Formula | C14H10Br2ClNO3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 432.87 |
| IUPAC Name | 4-chloro-N-(2,4-dibromo-5-methoxyphenyl)-2-hydroxybenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Cl)cc2O)c(Br)cc1Br |
| InChI | InChI=1S/C14H10Br2ClNO3/c1-21-13-6-11(9(15)5-10(13)16)18-14(20)8-3-2-7(17)4-12(8)19/h2-6,19H,1H3,(H,18,20) |
| InChIKey | MJOOKAZZTOBJRH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |