C15H13Br2NO3 — CID 107676866
N-(2,4-dibromo-5-methoxyphenyl)-4-hydroxy-3-methylbenzamide (PubChem CID 107676866) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-4-hydroxy-3-methylbenzamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-4-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 107676866 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-4-hydroxy-3-methylbenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(O)c(C)c2)c(Br)cc1Br |
| InChI | InChI=1S/C15H13Br2NO3/c1-8-5-9(3-4-13(8)19)15(20)18-12-7-14(21-2)11(17)6-10(12)16/h3-7,19H,1-2H3,(H,18,20) |
| InChIKey | CIPUHMZJWRBPFS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |